C11H8F6N6 — CID 135461015
4-[[2,4-bis(trifluoromethyl)phenyl]diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135461015) has the molecular formula C11H8F6N6 and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-[[2,4-bis(trifluoromethyl)phenyl]diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[[2,4-bis(trifluoromethyl)phenyl]diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135461015 |
| Molecular Formula | C11H8F6N6 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 4-[[2,4-bis(trifluoromethyl)phenyl]diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H8F6N6/c12-10(13,14)4-1-2-6(5(3-4)11(15,16)17)20-21-7-8(18)22-23-9(7)19/h1-3H,(H5,18,19,22,23)/b21-20+ |
| InChIKey | GFRLOPXBEWVPQE-QZQOTICOSA-N |
| XLogP | 4.03 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|