C12H11N7 — CID 135744091
4-(isoquinolin-5-yldiazenyl)-1H-pyrazole-3,5-diamine (PubChem CID 135744091) has the molecular formula C12H11N7 and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-(isoquinolin-5-yldiazenyl)-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(isoquinolin-5-yldiazenyl)-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135744091 |
| Molecular Formula | C12H11N7 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(isoquinolin-5-yldiazenyl)-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1cccc2cnccc12 |
| InChI | InChI=1S/C12H11N7/c13-11-10(12(14)19-18-11)17-16-9-3-1-2-7-6-15-5-4-8(7)9/h1-6H,(H5,13,14,18,19)/b17-16+ |
| InChIKey | BYWFSJHXCNLJEE-WUKNDPDISA-N |
| XLogP | 2.54 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|