About CID 159683901
CID 159683901 (PubChem CID 159683901) has the molecular formula C10H8N2S2
and a molecular weight of 220.32 g/mol.
Molecular Properties
| Compound Name | CID 159683901 |
| PubChem CID | 159683901 |
| Molecular Formula | C10H8N2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | — |
| SMILES | Nc1cccc2cnccc12.S=C=S |
| InChI | InChI=1S/C9H8N2.CS2/c10-9-3-1-2-7-6-11-5-4-8(7)9;2-1-3/h1-6H,10H2; |
| InChIKey | MVNVXVPOPFEKQD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 159683901 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159683901?
The IUPAC name of CID 159683901 (CID 159683901) is not available.
What is the SMILES notation for CID 159683901?
The canonical SMILES for CID 159683901 is Nc1cccc2cnccc12.S=C=S.
What is the InChIKey of CID 159683901?
The InChIKey is MVNVXVPOPFEKQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.CS2/c10-9-3-1-2-7-6-11-5-4-8(7)9;2-1-3/h1-6H,10H2;.
What are the key properties of CID 159683901?
CID 159683901 has a molecular weight of 220.32 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159683901 is sourced from PubChem (CID 159683901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).