About butanedioic acid;isoquinolin-5-amine
butanedioic acid;isoquinolin-5-amine (PubChem CID 158729130) has the molecular formula C13H14N2O4
and a molecular weight of 262.27 g/mol. Its IUPAC name is butanedioic acid;isoquinolin-5-amine.
Molecular Properties
| Compound Name | butanedioic acid;isoquinolin-5-amine |
| PubChem CID | 158729130 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | butanedioic acid;isoquinolin-5-amine |
| SMILES | Nc1cccc2cnccc12.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C9H8N2.C4H6O4/c10-9-3-1-2-7-6-11-5-4-8(7)9;5-3(6)1-2-4(7)8/h1-6H,10H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | IKWNSXNENFPOSK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;isoquinolin-5-amine?
The IUPAC name of butanedioic acid;isoquinolin-5-amine (CID 158729130) is butanedioic acid;isoquinolin-5-amine.
What is the SMILES notation for butanedioic acid;isoquinolin-5-amine?
The canonical SMILES for butanedioic acid;isoquinolin-5-amine is Nc1cccc2cnccc12.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;isoquinolin-5-amine?
The InChIKey is IKWNSXNENFPOSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C4H6O4/c10-9-3-1-2-7-6-11-5-4-8(7)9;5-3(6)1-2-4(7)8/h1-6H,10H2;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;isoquinolin-5-amine?
butanedioic acid;isoquinolin-5-amine has a molecular weight of 262.27 g/mol, XLogP of 1.75, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;isoquinolin-5-amine is sourced from PubChem (CID 158729130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).