About ethane;isoquinolin-5-amine
ethane;isoquinolin-5-amine (PubChem CID 143675367) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is ethane;isoquinolin-5-amine.
Molecular Properties
| Compound Name | ethane;isoquinolin-5-amine |
| PubChem CID | 143675367 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | ethane;isoquinolin-5-amine |
| SMILES | CC.CC.Nc1cccc2cnccc12 |
| InChI | InChI=1S/C9H8N2.2C2H6/c10-9-3-1-2-7-6-11-5-4-8(7)9;2*1-2/h1-6H,10H2;2*1-2H3 |
| InChIKey | WADLXJGRHANKSV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;isoquinolin-5-amine?
The IUPAC name of ethane;isoquinolin-5-amine (CID 143675367) is ethane;isoquinolin-5-amine.
What is the SMILES notation for ethane;isoquinolin-5-amine?
The canonical SMILES for ethane;isoquinolin-5-amine is CC.CC.Nc1cccc2cnccc12.
What is the InChIKey of ethane;isoquinolin-5-amine?
The InChIKey is WADLXJGRHANKSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.2C2H6/c10-9-3-1-2-7-6-11-5-4-8(7)9;2*1-2/h1-6H,10H2;2*1-2H3.
What are the key properties of ethane;isoquinolin-5-amine?
ethane;isoquinolin-5-amine has a molecular weight of 204.32 g/mol, XLogP of 3.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;isoquinolin-5-amine is sourced from PubChem (CID 143675367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).