C13H13N5 — CID 55011951
4-N-isoquinolin-5-yl-2-methyl-1H-imidazole-4,5-diamine (PubChem CID 55011951) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-N-isoquinolin-5-yl-2-methyl-1H-imidazole-4,5-diamine.
| Compound Name | 4-N-isoquinolin-5-yl-2-methyl-1H-imidazole-4,5-diamine |
|---|---|
| PubChem CID | 55011951 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-N-isoquinolin-5-yl-2-methyl-1H-imidazole-4,5-diamine |
| SMILES | Cc1nc(Nc2cccc3cnccc23)c(N)[nH]1 |
| InChI | InChI=1S/C13H13N5/c1-8-16-12(14)13(17-8)18-11-4-2-3-9-7-15-6-5-10(9)11/h2-7,18H,14H2,1H3,(H,16,17) |
| InChIKey | DTUUNEBAFYCBCJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |