About 1,3-dimethylimidazolidine;isoquinolin-5-amine
1,3-dimethylimidazolidine;isoquinolin-5-amine (PubChem CID 142986059) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 1,3-dimethylimidazolidine;isoquinolin-5-amine.
Molecular Properties
| Compound Name | 1,3-dimethylimidazolidine;isoquinolin-5-amine |
| PubChem CID | 142986059 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 1,3-dimethylimidazolidine;isoquinolin-5-amine |
| SMILES | CN1CCN(C)C1.Nc1cccc2cnccc12 |
| InChI | InChI=1S/C9H8N2.C5H12N2/c10-9-3-1-2-7-6-11-5-4-8(7)9;1-6-3-4-7(2)5-6/h1-6H,10H2;3-5H2,1-2H3 |
| InChIKey | KZNOEAYYCPMMHU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylimidazolidine;isoquinolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylimidazolidine;isoquinolin-5-amine?
The IUPAC name of 1,3-dimethylimidazolidine;isoquinolin-5-amine (CID 142986059) is 1,3-dimethylimidazolidine;isoquinolin-5-amine.
What is the SMILES notation for 1,3-dimethylimidazolidine;isoquinolin-5-amine?
The canonical SMILES for 1,3-dimethylimidazolidine;isoquinolin-5-amine is CN1CCN(C)C1.Nc1cccc2cnccc12.
What is the InChIKey of 1,3-dimethylimidazolidine;isoquinolin-5-amine?
The InChIKey is KZNOEAYYCPMMHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C5H12N2/c10-9-3-1-2-7-6-11-5-4-8(7)9;1-6-3-4-7(2)5-6/h1-6H,10H2;3-5H2,1-2H3.
What are the key properties of 1,3-dimethylimidazolidine;isoquinolin-5-amine?
1,3-dimethylimidazolidine;isoquinolin-5-amine has a molecular weight of 244.34 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylimidazolidine;isoquinolin-5-amine is sourced from PubChem (CID 142986059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).