About dichloromethane;naphthalen-1-amine
dichloromethane;naphthalen-1-amine (PubChem CID 174958204) has the molecular formula C11H11Cl2N
and a molecular weight of 228.12 g/mol. Its IUPAC name is dichloromethane;naphthalen-1-amine.
Molecular Properties
| Compound Name | dichloromethane;naphthalen-1-amine |
| PubChem CID | 174958204 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | dichloromethane;naphthalen-1-amine |
| SMILES | ClCCl.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N.CH2Cl2/c11-10-7-3-5-8-4-1-2-6-9(8)10;2-1-3/h1-7H,11H2;1H2 |
| InChIKey | DZPZZKJHZCYNML-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;naphthalen-1-amine?
The IUPAC name of dichloromethane;naphthalen-1-amine (CID 174958204) is dichloromethane;naphthalen-1-amine.
What is the SMILES notation for dichloromethane;naphthalen-1-amine?
The canonical SMILES for dichloromethane;naphthalen-1-amine is ClCCl.Nc1cccc2ccccc12.
What is the InChIKey of dichloromethane;naphthalen-1-amine?
The InChIKey is DZPZZKJHZCYNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.CH2Cl2/c11-10-7-3-5-8-4-1-2-6-9(8)10;2-1-3/h1-7H,11H2;1H2.
What are the key properties of dichloromethane;naphthalen-1-amine?
dichloromethane;naphthalen-1-amine has a molecular weight of 228.12 g/mol, XLogP of 3.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;naphthalen-1-amine is sourced from PubChem (CID 174958204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).