About naphthalen-1-amine;2-phenylethanamine
naphthalen-1-amine;2-phenylethanamine (PubChem CID 175144092) has the molecular formula C18H20N2
and a molecular weight of 264.37 g/mol. Its IUPAC name is naphthalen-1-amine;2-phenylethanamine.
Molecular Properties
| Compound Name | naphthalen-1-amine;2-phenylethanamine |
| PubChem CID | 175144092 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | naphthalen-1-amine;2-phenylethanamine |
| SMILES | NCCc1ccccc1.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N.C8H11N/c11-10-7-3-5-8-4-1-2-6-9(8)10;9-7-6-8-4-2-1-3-5-8/h1-7H,11H2;1-5H,6-7,9H2 |
| InChIKey | IREKHRPZQJBTJE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-amine;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-amine;2-phenylethanamine?
The IUPAC name of naphthalen-1-amine;2-phenylethanamine (CID 175144092) is naphthalen-1-amine;2-phenylethanamine.
What is the SMILES notation for naphthalen-1-amine;2-phenylethanamine?
The canonical SMILES for naphthalen-1-amine;2-phenylethanamine is NCCc1ccccc1.Nc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-amine;2-phenylethanamine?
The InChIKey is IREKHRPZQJBTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C8H11N/c11-10-7-3-5-8-4-1-2-6-9(8)10;9-7-6-8-4-2-1-3-5-8/h1-7H,11H2;1-5H,6-7,9H2.
What are the key properties of naphthalen-1-amine;2-phenylethanamine?
naphthalen-1-amine;2-phenylethanamine has a molecular weight of 264.37 g/mol, XLogP of 3.61, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-amine;2-phenylethanamine is sourced from PubChem (CID 175144092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).