About diazene;naphthalen-1-amine
diazene;naphthalen-1-amine (PubChem CID 142081772) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is diazene;naphthalen-1-amine.
Molecular Properties
| Compound Name | diazene;naphthalen-1-amine |
| PubChem CID | 142081772 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | diazene;naphthalen-1-amine |
| SMILES | Nc1cccc2ccccc12.[H]/N=N/[H] |
| InChI | InChI=1S/C10H9N.H2N2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7H,11H2;1-2H/b;2-1+ |
| InChIKey | DYVJWDQMLAPLOF-WLHGVMLRSA-N |
| XLogP | 3.02 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze diazene;naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazene;naphthalen-1-amine?
The IUPAC name of diazene;naphthalen-1-amine (CID 142081772) is diazene;naphthalen-1-amine.
What is the SMILES notation for diazene;naphthalen-1-amine?
The canonical SMILES for diazene;naphthalen-1-amine is Nc1cccc2ccccc12.[H]/N=N/[H].
What is the InChIKey of diazene;naphthalen-1-amine?
The InChIKey is DYVJWDQMLAPLOF-WLHGVMLRSA-N. The full InChI is InChI=1S/C10H9N.H2N2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7H,11H2;1-2H/b;2-1+.
What are the key properties of diazene;naphthalen-1-amine?
diazene;naphthalen-1-amine has a molecular weight of 173.22 g/mol, XLogP of 3.02, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazene;naphthalen-1-amine is sourced from PubChem (CID 142081772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).