C10H15N4P3 — CID 175083244
naphthalen-1-amine;1,3,5,2,4,6-triazatriphosphinane (PubChem CID 175083244) has the molecular formula C10H15N4P3 and a molecular weight of 284.18 g/mol. Its IUPAC name is naphthalen-1-amine;1,3,5,2,4,6-triazatriphosphinane.
| Compound Name | naphthalen-1-amine;1,3,5,2,4,6-triazatriphosphinane |
|---|---|
| PubChem CID | 175083244 |
| Molecular Formula | C10H15N4P3 |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | naphthalen-1-amine;1,3,5,2,4,6-triazatriphosphinane |
| SMILES | N1PNPNP1.Nc1cccc2ccccc12 |
| InChI | InChI=1S/C10H9N.H6N3P3/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-4-2-6-3-5-1/h1-7H,11H2;1-6H |
| InChIKey | ITUXWZFWUCVMRZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|