About 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine
4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135744090) has the molecular formula C10H13N7O2
and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine |
| PubChem CID | 135744090 |
| Molecular Formula | C10H13N7O2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | COc1ccc(/N=N/c2c(N)n[nH]c2N)c(OC)n1 |
| InChI | InChI=1S/C10H13N7O2/c1-18-6-4-3-5(10(13-6)19-2)14-15-7-8(11)16-17-9(7)12/h3-4H,1-2H3,(H5,11,12,16,17)/b15-14+ |
| InChIKey | GSOTWRXVGPGNNL-CCEZHUSRSA-N |
| XLogP | 1.40 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
The IUPAC name of 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine (CID 135744090) is 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
The canonical SMILES for 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine is COc1ccc(/N=N/c2c(N)n[nH]c2N)c(OC)n1.
What is the InChIKey of 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
The InChIKey is GSOTWRXVGPGNNL-CCEZHUSRSA-N. The full InChI is InChI=1S/C10H13N7O2/c1-18-6-4-3-5(10(13-6)19-2)14-15-7-8(11)16-17-9(7)12/h3-4H,1-2H3,(H5,11,12,16,17)/b15-14+.
What are the key properties of 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine has a molecular weight of 263.26 g/mol, XLogP of 1.40, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethoxy-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 135744090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).