C15H21N7O2 — CID 136610658
4-[(4-methoxy-2-methyl-3-morpholin-4-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 136610658) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-[(4-methoxy-2-methyl-3-morpholin-4-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(4-methoxy-2-methyl-3-morpholin-4-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 136610658 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[(4-methoxy-2-methyl-3-morpholin-4-ylphenyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | COc1ccc(/N=N/c2c(N)n[nH]c2N)c(C)c1N1CCOCC1 |
| InChI | InChI=1S/C15H21N7O2/c1-9-10(18-19-12-14(16)20-21-15(12)17)3-4-11(23-2)13(9)22-5-7-24-8-6-22/h3-4H,5-8H2,1-2H3,(H5,16,17,20,21)/b19-18+ |
| InChIKey | KENDDAUXTHVTRP-VHEBQXMUSA-N |
| XLogP | 2.14 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|