C15H16N4O2 — CID 86049209
2-amino-8-methoxy-5-morpholin-4-ylquinoline-3-carbonitrile (PubChem CID 86049209) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-amino-8-methoxy-5-morpholin-4-ylquinoline-3-carbonitrile.
| Compound Name | 2-amino-8-methoxy-5-morpholin-4-ylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 86049209 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-amino-8-methoxy-5-morpholin-4-ylquinoline-3-carbonitrile |
| SMILES | COc1ccc(N2CCOCC2)c2cc(C#N)c(N)nc12 |
| InChI | InChI=1S/C15H16N4O2/c1-20-13-3-2-12(19-4-6-21-7-5-19)11-8-10(9-16)15(17)18-14(11)13/h2-3,8H,4-7H2,1H3,(H2,17,18) |
| InChIKey | ALICLLKIXWBGTK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|