C21H20ClN5O2 — CID 151349652
5-amino-4-[(3-chloro-4-methoxyphenyl)methyl]-2-morpholin-4-ylquinazoline-6-carbonitrile (PubChem CID 151349652) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is 5-amino-4-[(3-chloro-4-methoxyphenyl)methyl]-2-morpholin-4-ylquinazoline-6-carbonitrile.
| Compound Name | 5-amino-4-[(3-chloro-4-methoxyphenyl)methyl]-2-morpholin-4-ylquinazoline-6-carbonitrile |
|---|---|
| PubChem CID | 151349652 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-amino-4-[(3-chloro-4-methoxyphenyl)methyl]-2-morpholin-4-ylquinazoline-6-carbonitrile |
| SMILES | COc1ccc(Cc2nc(N3CCOCC3)nc3ccc(C#N)c(N)c23)cc1Cl |
| InChI | InChI=1S/C21H20ClN5O2/c1-28-18-5-2-13(10-15(18)22)11-17-19-16(4-3-14(12-23)20(19)24)25-21(26-17)27-6-8-29-9-7-27/h2-5,10H,6-9,11,24H2,1H3 |
| InChIKey | OMFDVMHMJSHERF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|