C18H23N3O3 — CID 139342854
3-[(4-methoxyphenyl)methoxy]-5-morpholin-4-ylbenzene-1,2-diamine (PubChem CID 139342854) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methoxy]-5-morpholin-4-ylbenzene-1,2-diamine.
| Compound Name | 3-[(4-methoxyphenyl)methoxy]-5-morpholin-4-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 139342854 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[(4-methoxyphenyl)methoxy]-5-morpholin-4-ylbenzene-1,2-diamine |
| SMILES | COc1ccc(COc2cc(N3CCOCC3)cc(N)c2N)cc1 |
| InChI | InChI=1S/C18H23N3O3/c1-22-15-4-2-13(3-5-15)12-24-17-11-14(10-16(19)18(17)20)21-6-8-23-9-7-21/h2-5,10-11H,6-9,12,19-20H2,1H3 |
| InChIKey | OBQGSRVCINTGGN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|