C12H18N2O2 — CID 80735841
3-methoxy-5-(1,4-oxazepan-4-yl)aniline (PubChem CID 80735841) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-methoxy-5-(1,4-oxazepan-4-yl)aniline.
| Compound Name | 3-methoxy-5-(1,4-oxazepan-4-yl)aniline |
|---|---|
| PubChem CID | 80735841 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-methoxy-5-(1,4-oxazepan-4-yl)aniline |
| SMILES | COc1cc(N)cc(N2CCCOCC2)c1 |
| InChI | InChI=1S/C12H18N2O2/c1-15-12-8-10(13)7-11(9-12)14-3-2-5-16-6-4-14/h7-9H,2-6,13H2,1H3 |
| InChIKey | XAJQDNCMHVYZTI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|