C14H22N2OS — CID 107453075
3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methoxyaniline (PubChem CID 107453075) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methoxyaniline.
| Compound Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methoxyaniline |
|---|---|
| PubChem CID | 107453075 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(7,7-dimethyl-1,4-thiazepan-4-yl)-5-methoxyaniline |
| SMILES | COc1cc(N)cc(N2CCSC(C)(C)CC2)c1 |
| InChI | InChI=1S/C14H22N2OS/c1-14(2)4-5-16(6-7-18-14)12-8-11(15)9-13(10-12)17-3/h8-10H,4-7,15H2,1-3H3 |
| InChIKey | LONSKETUYLQEDK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|