C13H18Cl2N2S — CID 107453113
3,5-dichloro-4-(7,7-dimethyl-1,4-thiazepan-4-yl)aniline (PubChem CID 107453113) has the molecular formula C13H18Cl2N2S and a molecular weight of 305.27 g/mol. Its IUPAC name is 3,5-dichloro-4-(7,7-dimethyl-1,4-thiazepan-4-yl)aniline.
| Compound Name | 3,5-dichloro-4-(7,7-dimethyl-1,4-thiazepan-4-yl)aniline |
|---|---|
| PubChem CID | 107453113 |
| Molecular Formula | C13H18Cl2N2S |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 3,5-dichloro-4-(7,7-dimethyl-1,4-thiazepan-4-yl)aniline |
| SMILES | CC1(C)CCN(c2c(Cl)cc(N)cc2Cl)CCS1 |
| InChI | InChI=1S/C13H18Cl2N2S/c1-13(2)3-4-17(5-6-18-13)12-10(14)7-9(16)8-11(12)15/h7-8H,3-6,16H2,1-2H3 |
| InChIKey | FOGUBPFUBDSNNR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|