C14H21N3OS — CID 107458168
5-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzamide (PubChem CID 107458168) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 5-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzamide.
| Compound Name | 5-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzamide |
|---|---|
| PubChem CID | 107458168 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)benzamide |
| SMILES | CC1(C)CCN(c2ccc(N)cc2C(N)=O)CCS1 |
| InChI | InChI=1S/C14H21N3OS/c1-14(2)5-6-17(7-8-19-14)12-4-3-10(15)9-11(12)13(16)18/h3-4,9H,5-8,15H2,1-2H3,(H2,16,18) |
| InChIKey | SSYUWGAFXCOYER-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|