C16H24N2O2S — CID 107458181
ethyl 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)benzoate (PubChem CID 107458181) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is ethyl 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)benzoate.
| Compound Name | ethyl 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)benzoate |
|---|---|
| PubChem CID | 107458181 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | ethyl 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N)c(N2CCSC(C)(C)CC2)c1 |
| InChI | InChI=1S/C16H24N2O2S/c1-4-20-15(19)12-5-6-13(17)14(11-12)18-8-7-16(2,3)21-10-9-18/h5-6,11H,4,7-10,17H2,1-3H3 |
| InChIKey | WVHKVFCATHKHOV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|