C16H25N3OS — CID 107453044
4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)-N,N-dimethylbenzamide (PubChem CID 107453044) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 107453044 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-amino-3-(7,7-dimethyl-1,4-thiazepan-4-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(N2CCSC(C)(C)CC2)c1 |
| InChI | InChI=1S/C16H25N3OS/c1-16(2)7-8-19(9-10-21-16)14-11-12(5-6-13(14)17)15(20)18(3)4/h5-6,11H,7-10,17H2,1-4H3 |
| InChIKey | OMYIBTHFKJMDKJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|