C15H22N4O2 — CID 102888377
4-amino-N,N-dimethyl-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzamide (PubChem CID 102888377) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzamide |
|---|---|
| PubChem CID | 102888377 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-(4-methyl-3-oxo-1,4-diazepan-1-yl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(N2CCCN(C)C(=O)C2)c1 |
| InChI | InChI=1S/C15H22N4O2/c1-17(2)15(21)11-5-6-12(16)13(9-11)19-8-4-7-18(3)14(20)10-19/h5-6,9H,4,7-8,10,16H2,1-3H3 |
| InChIKey | XNYQZWYLPRWAEA-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|