C14H21N3OS — CID 82993380
3-amino-N,N-dimethyl-4-(1,4-thiazepan-4-yl)benzamide (PubChem CID 82993380) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-4-(1,4-thiazepan-4-yl)benzamide.
| Compound Name | 3-amino-N,N-dimethyl-4-(1,4-thiazepan-4-yl)benzamide |
|---|---|
| PubChem CID | 82993380 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-amino-N,N-dimethyl-4-(1,4-thiazepan-4-yl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(N2CCCSCC2)c(N)c1 |
| InChI | InChI=1S/C14H21N3OS/c1-16(2)14(18)11-4-5-13(12(15)10-11)17-6-3-8-19-9-7-17/h4-5,10H,3,6-9,15H2,1-2H3 |
| InChIKey | AFXSTWOEUCAROG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|