C17H19N3O — CID 63360632
4-amino-3-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzamide (PubChem CID 63360632) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-amino-3-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 63360632 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 4-amino-3-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H19N3O/c1-19(2)17(21)13-7-8-14(18)16(11-13)20-10-9-12-5-3-4-6-15(12)20/h3-8,11H,9-10,18H2,1-2H3 |
| InChIKey | PDUUQULGGDFVQS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|