C16H19N3 — CID 28809875
4-(2,3-dihydroindol-1-yl)-1-N,1-N-dimethylbenzene-1,3-diamine (PubChem CID 28809875) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-1-N,1-N-dimethylbenzene-1,3-diamine.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-1-N,1-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 28809875 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-1-N,1-N-dimethylbenzene-1,3-diamine |
| SMILES | CN(C)c1ccc(N2CCc3ccccc32)c(N)c1 |
| InChI | InChI=1S/C16H19N3/c1-18(2)13-7-8-16(14(17)11-13)19-10-9-12-5-3-4-6-15(12)19/h3-8,11H,9-10,17H2,1-2H3 |
| InChIKey | CPCXYDHYYNLIKP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|