C16H15N3O2 — CID 43479146
7-amino-6-(2,3-dihydroindol-1-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 43479146) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 7-amino-6-(2,3-dihydroindol-1-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(2,3-dihydroindol-1-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43479146 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 7-amino-6-(2,3-dihydroindol-1-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1N1CCc3ccccc31)NC(=O)CO2 |
| InChI | InChI=1S/C16H15N3O2/c17-11-7-15-12(18-16(20)9-21-15)8-14(11)19-6-5-10-3-1-2-4-13(10)19/h1-4,7-8H,5-6,9,17H2,(H,18,20) |
| InChIKey | PBEMDVHULZCIGT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|