C17H16N2O4S — CID 5295628
6-(2,3-dihydroindol-1-ylsulfonyl)-7-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 5295628) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-ylsulfonyl)-7-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,3-dihydroindol-1-ylsulfonyl)-7-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 5295628 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 6-(2,3-dihydroindol-1-ylsulfonyl)-7-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCc3ccccc31)NC(=O)CO2 |
| InChI | InChI=1S/C17H16N2O4S/c1-11-8-15-13(18-17(20)10-23-15)9-16(11)24(21,22)19-7-6-12-4-2-3-5-14(12)19/h2-5,8-9H,6-7,10H2,1H3,(H,18,20) |
| InChIKey | ZIPGKXWRLZXNHN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |