C19H20ClN3O4S — CID 22548354
7-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 22548354) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is 7-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22548354 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 7-[4-(3-chlorophenyl)piperazin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc2c(cc1S(=O)(=O)N1CCN(c3cccc(Cl)c3)CC1)OCC(=O)N2 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-13-9-16-17(27-12-19(24)21-16)11-18(13)28(25,26)23-7-5-22(6-8-23)15-4-2-3-14(20)10-15/h2-4,9-11H,5-8,12H2,1H3,(H,21,24) |
| InChIKey | LCOGOUQDDYFARA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |