C26H32N4O6S — CID 46288697
7-[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 46288697) has the molecular formula C26H32N4O6S and a molecular weight of 528.63 g/mol. Its IUPAC name is 7-[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46288697 |
| Molecular Formula | C26H32N4O6S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 7-[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]piperidin-1-yl]sulfonyl-6-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCN(S(=O)(=O)c4cc5c(cc4C)NC(=O)CO5)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H32N4O6S/c1-18-15-22-23(36-17-25(31)27-22)16-24(18)37(33,34)30-9-7-19(8-10-30)26(32)29-13-11-28(12-14-29)20-3-5-21(35-2)6-4-20/h3-6,15-16,19H,7-14,17H2,1-2H3,(H,27,31) |
| InChIKey | JCYVCGNTLNUVSV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|