C15H15N3O3 — CID 43479244
7-amino-6-(2-methoxyanilino)-4H-1,4-benzoxazin-3-one (PubChem CID 43479244) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 7-amino-6-(2-methoxyanilino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(2-methoxyanilino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43479244 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 7-amino-6-(2-methoxyanilino)-4H-1,4-benzoxazin-3-one |
| SMILES | COc1ccccc1Nc1cc2c(cc1N)OCC(=O)N2 |
| InChI | InChI=1S/C15H15N3O3/c1-20-13-5-3-2-4-10(13)17-11-7-12-14(6-9(11)16)21-8-15(19)18-12/h2-7,17H,8,16H2,1H3,(H,18,19) |
| InChIKey | XTRIBECYOHWAOF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|