C15H16N4O2 — CID 43524329
7-amino-6-(1-pyridin-2-ylethylamino)-4H-1,4-benzoxazin-3-one (PubChem CID 43524329) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 7-amino-6-(1-pyridin-2-ylethylamino)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(1-pyridin-2-ylethylamino)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43524329 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 7-amino-6-(1-pyridin-2-ylethylamino)-4H-1,4-benzoxazin-3-one |
| SMILES | CC(Nc1cc2c(cc1N)OCC(=O)N2)c1ccccn1 |
| InChI | InChI=1S/C15H16N4O2/c1-9(11-4-2-3-5-17-11)18-12-7-13-14(6-10(12)16)21-8-15(20)19-13/h2-7,9,18H,8,16H2,1H3,(H,19,20) |
| InChIKey | ISKXDPYLHGDVRV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|