C14H11IN2O3 — CID 43479561
7-amino-6-(2-iodophenoxy)-4H-1,4-benzoxazin-3-one (PubChem CID 43479561) has the molecular formula C14H11IN2O3 and a molecular weight of 382.16 g/mol. Its IUPAC name is 7-amino-6-(2-iodophenoxy)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(2-iodophenoxy)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43479561 |
| Molecular Formula | C14H11IN2O3 |
| Molecular Weight | 382.16 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 7-amino-6-(2-iodophenoxy)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1Oc1ccccc1I)NC(=O)CO2 |
| InChI | InChI=1S/C14H11IN2O3/c15-8-3-1-2-4-11(8)20-12-6-10-13(5-9(12)16)19-7-14(18)17-10/h1-6H,7,16H2,(H,17,18) |
| InChIKey | ALVRVOSVQFGSDA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|