C12H12N4O3 — CID 116792304
7-amino-6-(1-methylpyrazol-4-yl)oxy-4H-1,4-benzoxazin-3-one (PubChem CID 116792304) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 7-amino-6-(1-methylpyrazol-4-yl)oxy-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(1-methylpyrazol-4-yl)oxy-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 116792304 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 7-amino-6-(1-methylpyrazol-4-yl)oxy-4H-1,4-benzoxazin-3-one |
| SMILES | Cn1cc(Oc2cc3c(cc2N)OCC(=O)N3)cn1 |
| InChI | InChI=1S/C12H12N4O3/c1-16-5-7(4-14-16)19-10-3-9-11(2-8(10)13)18-6-12(17)15-9/h2-5H,6,13H2,1H3,(H,15,17) |
| InChIKey | AFGGVVBGJVLFMH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|