C12H14N2O4 — CID 55218657
7-amino-6-(oxolan-3-yloxy)-4H-1,4-benzoxazin-3-one (PubChem CID 55218657) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 7-amino-6-(oxolan-3-yloxy)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-amino-6-(oxolan-3-yloxy)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 55218657 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 7-amino-6-(oxolan-3-yloxy)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cc2c(cc1OC1CCOC1)NC(=O)CO2 |
| InChI | InChI=1S/C12H14N2O4/c13-8-3-11-9(14-12(15)6-17-11)4-10(8)18-7-1-2-16-5-7/h3-4,7H,1-2,5-6,13H2,(H,14,15) |
| InChIKey | WATWKBRXAOVHDX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|