C8H5FINO2 — CID 22625608
7-fluoro-6-iodo-4H-1,4-benzoxazin-3-one (PubChem CID 22625608) has the molecular formula C8H5FINO2 and a molecular weight of 293.04 g/mol. Its IUPAC name is 7-fluoro-6-iodo-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-fluoro-6-iodo-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 22625608 |
| Molecular Formula | C8H5FINO2 |
| Molecular Weight | 293.04 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | 7-fluoro-6-iodo-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(F)c(I)cc2N1 |
| InChI | InChI=1S/C8H5FINO2/c9-4-1-7-6(2-5(4)10)11-8(12)3-13-7/h1-2H,3H2,(H,11,12) |
| InChIKey | NOROHZUUWZNZGX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|