C7H5IN2O2 — CID 147566654
7-iodo-4H-pyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 147566654) has the molecular formula C7H5IN2O2 and a molecular weight of 276.03 g/mol. Its IUPAC name is 7-iodo-4H-pyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | 7-iodo-4H-pyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 147566654 |
| Molecular Formula | C7H5IN2O2 |
| Molecular Weight | 276.03 g/mol |
| Exact Mass | 275.94 |
| IUPAC Name | 7-iodo-4H-pyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2cc(I)ncc2N1 |
| InChI | InChI=1S/C7H5IN2O2/c8-6-1-5-4(2-9-6)10-7(11)3-12-5/h1-2H,3H2,(H,10,11) |
| InChIKey | FTRVPRATWSZAAW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.03 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|