C8H9N3O2 — CID 57145879
2-ethyl-5H-pyrimido[4,5-b][1,4]oxazin-6-one (PubChem CID 57145879) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-ethyl-5H-pyrimido[4,5-b][1,4]oxazin-6-one.
| Compound Name | 2-ethyl-5H-pyrimido[4,5-b][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 57145879 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-ethyl-5H-pyrimido[4,5-b][1,4]oxazin-6-one |
| SMILES | CCc1ncc2c(n1)OCC(=O)N2 |
| InChI | InChI=1S/C8H9N3O2/c1-2-6-9-3-5-8(11-6)13-4-7(12)10-5/h3H,2,4H2,1H3,(H,10,12) |
| InChIKey | HPPYNPRKVXYPQR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |