C10H15NO2S — CID 143502276
ethane;6-ethyl-1H-thieno[2,3-b][1,4]oxazin-2-one (PubChem CID 143502276) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is ethane;6-ethyl-1H-thieno[2,3-b][1,4]oxazin-2-one.
| Compound Name | ethane;6-ethyl-1H-thieno[2,3-b][1,4]oxazin-2-one |
|---|---|
| PubChem CID | 143502276 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | ethane;6-ethyl-1H-thieno[2,3-b][1,4]oxazin-2-one |
| SMILES | CC.CCc1cc2c(s1)OCC(=O)N2 |
| InChI | InChI=1S/C8H9NO2S.C2H6/c1-2-5-3-6-8(12-5)11-4-7(10)9-6;1-2/h3H,2,4H2,1H3,(H,9,10);1-2H3 |
| InChIKey | OZNACRLDCJHBGJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |