C13H12N2O2S2 — CID 82362812
6-(5-ethyl-2-sulfanylidene-3H-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one (PubChem CID 82362812) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 6-(5-ethyl-2-sulfanylidene-3H-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(5-ethyl-2-sulfanylidene-3H-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82362812 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 6-(5-ethyl-2-sulfanylidene-3H-1,3-thiazol-4-yl)-4H-1,4-benzoxazin-3-one |
| SMILES | CCc1sc(=S)[nH]c1-c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C13H12N2O2S2/c1-2-10-12(15-13(18)19-10)7-3-4-9-8(5-7)14-11(16)6-17-9/h3-5H,2,6H2,1H3,(H,14,16)(H,15,18) |
| InChIKey | LEVAAFWMPMHWJC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|