C11H13NO2S — CID 82355418
6-propylsulfanyl-4H-1,4-benzoxazin-3-one (PubChem CID 82355418) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 6-propylsulfanyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-propylsulfanyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82355418 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 6-propylsulfanyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCCSc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C11H13NO2S/c1-2-5-15-8-3-4-10-9(6-8)12-11(13)7-14-10/h3-4,6H,2,5,7H2,1H3,(H,12,13) |
| InChIKey | KTQBODBLWOOKEJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |