C10H12FNO2 — CID 143760014
fluoromethane;6-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 143760014) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is fluoromethane;6-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | fluoromethane;6-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 143760014 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | fluoromethane;6-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CF.Cc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C9H9NO2.CH3F/c1-6-2-3-8-7(4-6)10-9(11)5-12-8;1-2/h2-4H,5H2,1H3,(H,10,11);1H3 |
| InChIKey | CWPGNWYWAYDSDZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |