C16H13NO3 — CID 43161468
6-(3-methylbenzoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 43161468) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is 6-(3-methylbenzoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3-methylbenzoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43161468 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 6-(3-methylbenzoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(C(=O)c2ccc3c(c2)NC(=O)CO3)c1 |
| InChI | InChI=1S/C16H13NO3/c1-10-3-2-4-11(7-10)16(19)12-5-6-14-13(8-12)17-15(18)9-20-14/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | VLMVEJDSRSYLFU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |