C15H11NO3 — CID 3087778
7-benzoyl-4H-1,4-benzoxazin-3-one (PubChem CID 3087778) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 7-benzoyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-benzoyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3087778 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 7-benzoyl-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C15H11NO3/c17-14-9-19-13-8-11(6-7-12(13)16-14)15(18)10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17) |
| InChIKey | TZRNVVWHEHJLOL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |