C15H10ClNO3 — CID 3087782
7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one (PubChem CID 3087782) has the molecular formula C15H10ClNO3 and a molecular weight of 287.70 g/mol. Its IUPAC name is 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3087782 |
| Molecular Formula | C15H10ClNO3 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 7-(4-chlorobenzoyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)c3ccc(Cl)cc3)ccc2N1 |
| InChI | InChI=1S/C15H10ClNO3/c16-11-4-1-9(2-5-11)15(19)10-3-6-12-13(7-10)20-8-14(18)17-12/h1-7H,8H2,(H,17,18) |
| InChIKey | BBUISRBREJZENZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |