C12H10ClNO4 — CID 71900585
2-chloroprop-2-enyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate (PubChem CID 71900585) has the molecular formula C12H10ClNO4 and a molecular weight of 267.67 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate.
| Compound Name | 2-chloroprop-2-enyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate |
|---|---|
| PubChem CID | 71900585 |
| Molecular Formula | C12H10ClNO4 |
| Molecular Weight | 267.67 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 2-chloroprop-2-enyl 3-oxo-4H-1,4-benzoxazine-7-carboxylate |
| SMILES | C=C(Cl)COC(=O)c1ccc2c(c1)OCC(=O)N2 |
| InChI | InChI=1S/C12H10ClNO4/c1-7(13)5-18-12(16)8-2-3-9-10(4-8)17-6-11(15)14-9/h2-4H,1,5-6H2,(H,14,15) |
| InChIKey | WWMWXYGBLSJVCC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |