C14H11NO4 — CID 43463267
6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 43463267) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is 6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43463267 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1occc1C(=O)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H11NO4/c1-8-10(4-5-18-8)14(17)9-2-3-12-11(6-9)15-13(16)7-19-12/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | YAJZAQPQRFTMCJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |