C15H13NO4 — CID 43463663
2-methyl-6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 43463663) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-methyl-6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-methyl-6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43463663 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-methyl-6-(2-methylfuran-3-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1occc1C(=O)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C15H13NO4/c1-8-11(5-6-19-8)14(17)10-3-4-13-12(7-10)16-15(18)9(2)20-13/h3-7,9H,1-2H3,(H,16,18) |
| InChIKey | QWFZDEWBHBLYHG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |