C14H17NO3 — CID 43162307
6-(2,2-dimethylpropanoyl)-2-methyl-4H-1,4-benzoxazin-3-one (PubChem CID 43162307) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 6-(2,2-dimethylpropanoyl)-2-methyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(2,2-dimethylpropanoyl)-2-methyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 43162307 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 6-(2,2-dimethylpropanoyl)-2-methyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccc(C(=O)C(C)(C)C)cc2NC1=O |
| InChI | InChI=1S/C14H17NO3/c1-8-13(17)15-10-7-9(5-6-11(10)18-8)12(16)14(2,3)4/h5-8H,1-4H3,(H,15,17) |
| InChIKey | SHKYRXUIJYUZPF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |