C10H11N3O2 — CID 82492025
2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboximidamide (PubChem CID 82492025) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboximidamide.
| Compound Name | 2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboximidamide |
|---|---|
| PubChem CID | 82492025 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-methyl-3-oxo-4H-1,4-benzoxazine-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)NC(=O)C(C)O2 |
| InChI | InChI=1S/C10H11N3O2/c1-5-10(14)13-7-4-6(9(11)12)2-3-8(7)15-5/h2-5H,1H3,(H3,11,12)(H,13,14) |
| InChIKey | WGZIFKHKIXBAJE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|